BIOPEP-UWM: Report
| ID | 195 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 8 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 684.8636 | Monoisotopic mass | 684.4197 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Tada M., Okai H., Fukui S. | |
| Title | |
| Bitter taste of synthetic C-terminal tetradecapeptide of bovine beta-casein, H-Pro196-Val-Leu-Gly-Pro-Val-Arg-Gly-Pro-Phe-Pro-Ile-Ile-Val209-OH, and its related peptides. Agric. Biol. Chem., 49, 2587-2596 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)[C@H](CC)C)[C@H](CC)C)CCC2)Cc2ccccc2)CCC1 InChI=1S/C36H56N6O7/c1-7-22(5)29(34(46)41-30(23(6)8-2)33(45)39-28(21(3)4)36(48)49)40-32(44)27-17-13-19-42(27)35(47)26(20-24-14-10-9-11-15-24)38-31(43)25-16-12-18-37-25/h9-11,14-15,21-23,25-30,37H,7-8,12-13,16-20H2,1-6H3,(H,38,43)(H,39,45)(H,40,44)(H,41,46)(H,48,49)/t22-,23-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey: DWGXVIGYXQGMIP-CJKZIAQFSA-N |
| Database reference: |