BIOPEP-UWM: Report
| ID | 201 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 628.7576 | Monoisotopic mass | 628.3573 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)O)CCC2)Cc2ccccc2)CCC1)C)C(C)C)C(C)C InChI=1S/C32H48N6O7/c1-18(2)25(33)28(40)36-26(19(3)4)29(41)34-20(5)30(42)37-15-9-13-23(37)27(39)35-22(17-21-11-7-6-8-12-21)31(43)38-16-10-14-24(38)32(44)45/h6-8,11-12,18-20,22-26H,9-10,13-17,33H2,1-5H3,(H,34,41)(H,35,39)(H,36,40)(H,44,45)/t20-,22-,23-,24-,25-,26-/m0/s1 InChIKey: RNYMWTRJDNGDAC-YNAZAZDCSA-N |
| Database reference: |