BIOPEP-UWM: Report
| ID | 202 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 7 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 757.8713 | Monoisotopic mass | 757.3997 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CCC2)Cc2ccccc2)CCC1)C)C(C)C)C(C)C InChI=1S/C37H55N7O10/c1-20(2)29(38)33(49)42-30(21(3)4)34(50)39-22(5)35(51)43-17-9-13-26(43)32(48)41-25(19-23-11-7-6-8-12-23)36(52)44-18-10-14-27(44)31(47)40-24(37(53)54)15-16-28(45)46/h6-8,11-12,20-22,24-27,29-30H,9-10,13-19,38H2,1-5H3,(H,39,50)(H,40,47)(H,41,48)(H,42,49)(H,45,46)(H,53,54)/t22-,24-,25-,26-,27-,29-,30-/m0/s1 InChIKey: IKNDEGVSCVTYSF-KNWHVVHCSA-N |
| Database reference: |