BIOPEP-UWM: Report
| ID | 203 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 857.0020 | Monoisotopic mass | 856.4679 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)CCC(=O)O)CCC2)Cc2ccccc2)CCC1)C)C(C)C)C(C)C InChI=1S/C42H64N8O11/c1-22(2)32(43)38(56)47-33(23(3)4)39(57)44-25(7)40(58)49-19-11-15-29(49)37(55)46-28(21-26-13-9-8-10-14-26)41(59)50-20-12-16-30(50)36(54)45-27(17-18-31(51)52)35(53)48-34(24(5)6)42(60)61/h8-10,13-14,22-25,27-30,32-34H,11-12,15-21,43H2,1-7H3,(H,44,57)(H,45,54)(H,46,55)(H,47,56)(H,48,53)(H,51,52)(H,60,61)/t25-,27-,28-,29-,30-,32-,33-,34-/m0/s1 InChIKey: BPKLWMGUSRSBJM-RCFYKEGRSA-N |
| Database reference: |