BIOPEP-UWM: Report
| ID | 208 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 825.9517 | Monoisotopic mass | 825.4484 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)N1[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N2[C@@H](C(=O)N[C@H](C(=O)N3[C@@H](C(=O)O)CCC3)Cc3ccccc3)CCC2)CCCNC(=N)N)C(C)C)CCC1 InChI=1S/C39H59N11O9/c1-23(2)32(47-35(55)28-14-7-17-48(28)30(51)21-40)36(56)45-25(12-6-16-43-39(41)42)33(53)44-22-31(52)49-18-8-13-27(49)34(54)46-26(20-24-10-4-3-5-11-24)37(57)50-19-9-15-29(50)38(58)59/h3-5,10-11,23,25-29,32H,6-9,12-22,40H2,1-2H3,(H,44,53)(H,45,56)(H,46,54)(H,47,55)(H,58,59)(H4,41,42,43)/t25-,26-,27+,28+,29+,32-/m0/s1 InChIKey: FKNBJJYPKQOTML-SARIDPDDSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 5710 |