BIOPEP-UWM: Report
| ID | 209 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 671.7856 | Monoisotopic mass | 671.3744 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N1[C@@H](C(=O)N[C@H](C(=O)N2[C@@H](C(=O)O)CCC2)Cc2ccccc2)CCC1)CCCNC(=N)N)C(C)C InChI=1S/C32H49N9O7/c1-19(2)26(33)29(45)38-21(11-6-14-36-32(34)35)27(43)37-18-25(42)40-15-7-12-23(40)28(44)39-22(17-20-9-4-3-5-10-20)30(46)41-16-8-13-24(41)31(47)48/h3-5,9-10,19,21-24,26H,6-8,11-18,33H2,1-2H3,(H,37,43)(H,38,45)(H,39,44)(H,47,48)(H4,34,35,36)/t21-,22-,23+,24+,26-/m0/s1 InChIKey: PNYMARUNMYYKBV-KLCIVUIPSA-N Inhbitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 2506; 4336; 5397; 5692 |