BIOPEP-UWM: Report
| ID | 210 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 685.8121 | Monoisotopic mass | 685.3900 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino AIDS SMILES: N[C@H](C(=O)NCC(=O)N1[C@@H](C(=O)N[C@H](C(=O)N2[C@@H](C(=O)N[C@H](C(=O)O)[C@H](CC)C)CCC2)Cc2ccccc2)CCC1)CCCNC(=N)N InChI=1S/C33H51N9O7/c1-3-20(2)27(32(48)49)40-30(46)25-14-9-17-42(25)31(47)23(18-21-10-5-4-6-11-21)39-29(45)24-13-8-16-41(24)26(43)19-38-28(44)22(34)12-7-15-37-33(35)36/h4-6,10-11,20,22-25,27H,3,7-9,12-19,34H2,1-2H3,(H,38,44)(H,39,45)(H,40,46)(H,48,49)(H4,35,36,37)/t20-,22-,23-,24+,25+,27-/m0/s1 InChIKey: NNFNVJXYWKWZTB-MWIMSPEESA-N Yeast pheromone according to EROP-Moscow database |
| Database reference: |
| BRENDA: Ligand Arg-Gly-Pro-Phe-Pro-Ile EROP-Moscow: ID E00174 |