BIOPEP-UWM: Report
| ID | 211 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 416.4697 | Monoisotopic mass | 416.2053 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)O)CCC2)Cc2ccccc2)CCC1 InChI=1S/C21H28N4O5/c22-13-18(26)24-10-4-8-16(24)19(27)23-15(12-14-6-2-1-3-7-14)20(28)25-11-5-9-17(25)21(29)30/h1-3,6-7,15-17H,4-5,8-13,22H2,(H,23,27)(H,29,30)/t15-,16-,17-/m0/s1 InChIKey: QLKOHZYBHDMQGI-ULQDDVLXSA-N |
| Database reference: |
| ChemSpider: ID 9692055 PubChem: ID 11517267 |