BIOPEP-UWM: Report
| ID | 215 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 616.6594 | Monoisotopic mass | 616.3057 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CCC(=O)O)CC(=O)N)[C@H](CC)C)CCC(=O)O InChI=1S/C26H44N6O11/c1-5-13(4)21(32-22(38)14(27)6-8-19(34)35)25(41)30-16(11-18(28)33)24(40)29-15(7-9-20(36)37)23(39)31-17(26(42)43)10-12(2)3/h12-17,21H,5-11,27H2,1-4H3,(H2,28,33)(H,29,40)(H,30,41)(H,31,39)(H,32,38)(H,34,35)(H,36,37)(H,42,43)/t13-,14-,15-,16-,17-,21-/m0/s1 InChIKey: XHCDASRLGFAJFJ-CGROFBNBSA-N |
| Database reference: |