BIOPEP-UWM: Report
| ID | 216 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 3 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 331.3209 | Monoisotopic mass | 331.1374 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CO)CCC1 InChI=1S/C13H21N3O7/c17-6-9(16-11(20)7-2-1-5-14-7)12(21)15-8(13(22)23)3-4-10(18)19/h7-9,14,17H,1-6H2,(H,15,21)(H,16,20)(H,18,19)(H,22,23)/t7-,8-,9-/m0/s1 InChIKey: FNGOXVQBBCMFKV-CIUDSAMLSA-N |
| Database reference: |