BIOPEP-UWM: Report
| ID | 217 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 3 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 431.4859 | Monoisotopic mass | 431.2485 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)O InChI=1S/C17H33N7O6/c18-8-2-1-5-11(15(28)24-12(16(29)30)6-7-13(25)26)23-14(27)10(19)4-3-9-22-17(20)21/h10-12H,1-9,18-19H2,(H,23,27)(H,24,28)(H,25,26)(H,29,30)(H4,20,21,22)/t10-,11-,12-/m0/s1 InChiKey: CVXXSWQORBZAAA-SRVKXCTJSA-N |
| Database reference: |
| BRENDA: Ligand Arg-Lys-Glu ChemIDplus: ID 105803007 ChemSpider: ID 114390 PubChem: ID 129123 |