BIOPEP-UWM: Report
| ID | 218 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 561.5844 | Monoisotopic mass | 561.2749 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCCN)C(=O)O InChI=1S/C22H39N7O10/c1-11(26-19(35)12(24)10-30)18(34)27-14(6-8-17(32)33)20(36)28-13(5-7-16(25)31)21(37)29-15(22(38)39)4-2-3-9-23/h11-15,30H,2-10,23-24H2,1H3,(H2,25,31)(H,26,35)(H,27,34)(H,28,36)(H,29,37)(H,32,33)(H,38,39)/t11-,12-,13-,14-,15-/m0/s1 InChIKey: IJKWKZBCIREUDU-YTFOTSKYSA-N |
| Database reference: |