BIOPEP-UWM: Report
| ID | 219 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 6 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 730.7618 | Monoisotopic mass | 730.3485 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CCC(=O)O)CC(=O)N)[C@H](CC)C)CC(=O)N)CCC(=O)O InChI=1S/C30H50N8O13/c1-5-14(4)24(38-28(48)18(12-21(33)40)35-25(45)15(31)6-8-22(41)42)29(49)36-17(11-20(32)39)27(47)34-16(7-9-23(43)44)26(46)37-19(30(50)51)10-13(2)3/h13-19,24H,5-12,31H2,1-4H3,(H2,32,39)(H2,33,40)(H,34,47)(H,35,45)(H,36,49)(H,37,46)(H,38,48)(H,41,42)(H,43,44)(H,50,51)/t14-,15-,16-,17-,18-,19-,24-/m0/s1 InChIKey: RQECDJCXLVOVIP-NXGNMCDISA-N |
| Database reference: |