BIOPEP-UWM: Report
| ID | 220 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 4 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 487.5457 | Monoisotopic mass | 487.2633 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino AIDS SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CCC(=O)O)CC(=O)N)[C@H](CC)C InChI=1S/C21H37N5O8/c1-5-11(4)17(23)20(32)25-13(9-15(22)27)19(31)24-12(6-7-16(28)29)18(30)26-14(21(33)34)8-10(2)3/h10-14,17H,5-9,23H2,1-4H3,(H2,22,27)(H,24,31)(H,25,32)(H,26,30)(H,28,29)(H,33,34)/t11-,12-,13-,14-,17-/m0/s1 INChIKey: BPMQHTCDVVUHHS-DEEHTKSCSA-N |
| Database reference: |