BIOPEP-UWM: Report
| ID | 224 |
| Name | Manchego cheese peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 4 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 501.5722 | Monoisotopic mass | 501.2789 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gomez-Ruiz J. A., Taborda G., Amigo L., Ramos M., Molina E. | |
| Title | |
| Sensory and mass spectrometric analysis of the peptidic fraction lower than one thousand daltons in Manchego cheese. J. Dairy Sci., 90, 4966-4973 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CCC(=O)N)CCC(=O)O)CC(C)C InChI=1S/C22H39N5O8/c1-11(2)9-13(23)19(31)25-15(6-8-18(29)30)20(32)26-14(5-7-17(24)28)21(33)27-16(22(34)35)10-12(3)4/h11-16H,5-10,23H2,1-4H3,(H2,24,28)(H,25,31)(H,26,32)(H,27,33)(H,29,30)(H,34,35)/t13-,14-,15-,16-/m0/s1 InChIKey: SGPFSRGXCWRJQP-VGWMRTNUSA-N Inhibitor of Angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 1780 |