BIOPEP-UWM: Report
| ID | 235 |
| Name | Sweet amino acid |
| sequence |
| Function: | |||
| Sweet taste | |||
| Number of residues | 1 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 146.1870 | Monoisotopic mass | 146.1052 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kuramitsu R., Takahashi M., Tahara K., Nakamura K., Okai H. | |
| Title | |
| Tastes produced by peptides containing ionic groups and by related compounds. Biosci., Biotech., Biochem., 60, 1637-1642, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCCN)C(=O)O InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 InChIKey: KDXKERNSBIXSRK-YFKPBYRVSA-N sour amino acid according to the BIOPEP database of sensory peptides and amino acids (ID 234); bitter amino acid according to the BIOPEP database of sensory peptides and amino acids (ID 236); astringent amino acid according to the BIOPEP database of sensory peptides and amino acids (ID 237); bitterness suppressing amino acid according to the BIOPEP database of sensory peptides and amino acids (ID 372) pH =4 sour; pH = 4-9.83 bitter; pH = 4-9.83 sweet; pH = 9.83 astringent Kuramitsu R., Takahashi M., Tahara K., Nakamura K., Okai H., 1996, Tastes produced by peptides containing ionic groups and by related compounds. Biosci., Biotech., Biochem., 60, 1637-1642 |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 234; 236; 237; 372 BRENDA: Ligand Lys ChEBI: ID 18019 ChEMBL: ID CHEMBL8085 ChemIDplus: ID 000056871 ChemSpider: ID 5747 DrugBank: ID DB00123 Human Metabolome Database (HMDB): ID HMDB00182 KEGG: Compound C00047 NIST Chemistry WebBook: ID 2310649932 PubChem: ID 5962 ZINC: ID ZINC01532522 |