BIOPEP-UWM: Report
| ID | 24 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.83 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 369.4134 | Monoisotopic mass | 369.1683 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)NCC(=O)N[C@H](C(=O)O)Cc1ccccc1)Cc1ccccc1 InChI=1S/C20H23N3O4/c21-16(11-14-7-3-1-4-8-14)19(25)22-13-18(24)23-17(20(26)27)12-15-9-5-2-6-10-15/h1-10,16-17H,11-13,21H2,(H,22,25)(H,23,24)(H,26,27)/t16-,17-/m0/s1 InChIKey: NHCKESBLOMHIIE-IRXDYDNUSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 4557; 4850; 5471 ChemSpider: ID 8445918 PubChem: ID 10270439 |