BIOPEP-UWM: Report
| ID | 252 |
| Name | Sweet peptide |
| sequence |
| Function: | |||
| Sweet taste | |||
| Number of residues | 3 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 203.1953 | Monoisotopic mass | 203.0903 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S. | |
| Title | |
| Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)NCC(=O)N[C@@H](C)C(=O)O InChI=1S/C7H13N3O4/c1-4(7(13)14)10-6(12)3-9-5(11)2-8/h4H,2-3,8H2,1H3,(H,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 InChIKey: CCQOOWAONKGYKQ-BYPYZUCNSA-N Inhibitor of Cytosol alanyl aminopeptidase (EC 3.4.11.14) (MEROPS ID: M01.010) according to BRENDA database Inhibitor of citrulline uptake in yeasts according to ChEMBL database |
| Database reference: |
| BRENDA: Ligand Gly-Gly-Ala ChEBI: ID 73899 ChEMBL: ID CHEMBL1221830 ChemSpider: ID 5360515 PubChem: ID 6992377 ZINC: ID ZINC01575500 |