BIOPEP-UWM: Report
| ID | 264 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Number of residues | 2 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 232.2331 | Monoisotopic mass | 232.1055 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S. | |
| Title | |
| Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O InChI=1S/C9H16N2O5/c1-4(2)7(10)8(14)11-5(9(15)16)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t5-,7-/m0/s1 InChIKey: OBTCMSPFOITUIJ-FSPLSTOPSA-N Annotated as bitter/umami/sour Ishibashi N., Ono I., Kato K., Shigenaga T., Shinoda I., Okai H., Fukui S., 1988, Role of the hydrophobic amino acid residue in the bitterness of peptides. Agric. Biol. Chem., 52, 91-94 Bitter taste according to BIOPEP database of sensory peptides and amino acids (ID 134) Sour taste according to BIOPEP database of sensory peptides and amino acids (ID 265) Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1; MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 5437; 5445 BIOPEP database of sensory peptides and amino acids: ID 134; 265 ChEBI: ID 75009 ChemSpider: ID 5373188 EROP-Moscow: ID E01853 PubChem: ID 7009608 ZINC: ID ZINC02384834 |