BIOPEP-UWM: Report
| ID | 269 |
| Name | Delicious peptide (sour) |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | sou |
| Activity : | sour |
|||
| Chemical mass | 847.8648 | Monoisotopic mass | 847.3909 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yamasaki Y., Maekawa K. | |
| Title | |
| A peptide with delicious taste. Agric. Biol. Chem., 42, 1761-1765, 1978 | |
| Year | Source |
| 1978 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)O InChI=1S/C34H57N9O16/c1-16(2)12-21(31(55)38-17(3)34(58)59)42-33(57)23(15-44)43-30(54)20(8-10-26(48)49)40-29(53)19(7-9-25(46)47)41-32(56)22(13-27(50)51)39-24(45)14-37-28(52)18(36)6-4-5-11-35/h16-23,44H,4-15,35-36H2,1-3H3,(H,37,52)(H,38,55)(H,39,45)(H,40,53)(H,41,56)(H,42,57)(H,43,54)(H,46,47)(H,48,49)(H,50,51)(H,58,59)/t17-,18-,19-,20-,21-,22-,23-/m0/s1 InChIKey: JYGRAOYMDDFOSM-FQJIPJFPSA-N Taste annotated as umami/sour at acidic pH and umami at pH 6: Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H., 1995, Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693; Obtained from beef meat hydrolysate: Yamasaki Y., Maekawa K., 1978, A peptide with delicious taste. Agric. Biol. Chem., 42, 1761-1765 Umami taste: BIOPEP ID 268 |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 268 ChemSpider: ID 9269228 PubChem: ID 11094085 |