BIOPEP-UWM: Report
| ID | 27 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.04 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 328.3665 | Monoisotopic mass | 328.1854 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Authors Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1CCC[C@@H]1C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C13H24N6O4/c14-13(15)17-6-2-4-9(12(22)23)19-10(20)7-18-11(21)8-3-1-5-16-8/h8-9,16H,1-7H2,(H,18,21)(H,19,20)(H,22,23)(H4,14,15,17)/t8-,9+/m1/s1 InChIKey: DMKWYMWNEKIPFC-BDAKNGLRSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 2715; 4575; 4857; 5489; 6122 |