BIOPEP-UWM: Report
| ID | 276 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 3 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 363.2768 | Monoisotopic mass | 363.0909 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H. | |
| Title | |
| Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: C([C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)N)C(=O)O InChI=1S/C12H17N3O10/c13-4(1-7(16)17)10(22)14-5(2-8(18)19)11(23)15-6(12(24)25)3-9(20)21/h4-6H,1-3,13H2,(H,14,22)(H,15,23)(H,16,17)(H,18,19)(H,20,21)(H,24,25)/t4-,5-,6-/m0/s1 InChIKey: VPSHHQXIWLGVDD-ZLUOBGJFSA-N Annotated as salty/umami at pH 6 Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H., 1995, Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693; salty peptide according to BIOPEP database of sensory peptides and amino acids (ID 275) |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 275 ChemSpider: ID 23116177 |