BIOPEP-UWM: Report
| ID | 28 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 1.25 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 328.3665 | Monoisotopic mass | 328.1854 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)NCC(=O)O InChI=1S/C13H24N6O4/c14-8(3-1-5-17-13(15)16)12(23)19-6-2-4-9(19)11(22)18-7-10(20)21/h8-9H,1-7,14H2,(H,18,22)(H,20,21)(H4,15,16,17)/t8-,9+/m0/s1 InChiKey: HGKHPCFTRQDHCU-DTWKUNHWSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database |
| Database reference: |
| AHTPDB: ID 4544; 4823; 5458 ChemSpider: ID 10162438 PubChem: ID 11989971 |