BIOPEP-UWM: Report
| ID | 287 |
| Name | salty peptide |
| sequence |
| Function: | |||
| Salty taste | |||
| Number of residues | 3 |
Activity code | sal |
| Activity : | salty |
|||
| Chemical mass | 391.3298 | Monoisotopic mass | 391.1221 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H. | |
| Title | |
| Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CC(=O)O)CCC(=O)O InChI=1S/C14H21N3O10/c15-6(1-3-9(18)19)12(24)17-8(5-11(22)23)13(25)16-7(14(26)27)2-4-10(20)21/h6-8H,1-5,15H2,(H,16,25)(H,17,24)(H,18,19)(H,20,21)(H,22,23)(H,26,27)/t6-,7-,8-/m0/s1 InChIKey: XXCDTYBVGMPIOA-FXQIFTODSA-N Annotated as salty/umami at pH 6: Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H., 1995, Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693; umami peptide according to BIOPEP database of sensory peptides and amino acids |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 286 ChemSpider: ID 17280247 EROP-Moscow: ID E01856 PubChem: ID 16123342 |