BIOPEP-UWM: Report
| ID | 292 |
| Name | sweet peptide |
| sequence |
| Function: | |||
| Sweet taste | |||
| Number of residues | 3 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 318.3254 | Monoisotopic mass | 318.1534 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H. | |
| Title | |
| Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: O=C(N[C@H](C(=O)O)CC(=O)O)CNC(=O)[C@@H](N)CCCCN InChI=1S/C12H22N4O6/c13-4-2-1-3-7(14)11(20)15-6-9(17)16-8(12(21)22)5-10(18)19/h7-8H,1-6,13-14H2,(H,15,20)(H,16,17)(H,18,19)(H,21,22)/t7-,8-/m0/s1 InChIKey: GPJGFSFYBJGYRX-YUMQZZPRSA-N Annotated as sweet at pH 6: Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H., 1995, Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693 |
| Database reference: |
| ChemSpider: ID 8533941 PubChem: ID 10358492 |