BIOPEP-UWM: Report
| ID | 294 |
| Name | umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 8 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 847.8648 | Monoisotopic mass | 847.3909 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H. | |
| Title | |
| Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)O InChI=1S/C34H57N9O16/c1-16(2)12-22(43-29(54)18(36)15-44)33(58)38-17(3)28(53)42-23(13-26(49)50)34(59)41-21(8-10-25(47)48)32(57)40-20(7-9-24(45)46)31(56)39-19(6-4-5-11-35)30(55)37-14-27(51)52/h16-23,44H,4-15,35-36H2,1-3H3,(H,37,55)(H,38,58)(H,39,56)(H,40,57)(H,41,59)(H,42,53)(H,43,54)(H,45,46)(H,47,48)(H,49,50)(H,51,52)/t17-,18-,19-,20-,21-,22-,23-/m0/s1 InChIKey: GTFCNLCRJNDNHE-FQJIPJFPSA-N Annotated as umami at pH 6 and umami/sour in acidic environment: Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H., 1995, Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693 Sour peptide according to BIOPEP database of sensory peptides and amino acids |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 295 |