BIOPEP-UWM: Report
| ID | 301 |
| Name | sour peptide |
| sequence |
| Function: | |||
| Sour taste | |||
| Number of residues | 5 |
Activity code | sou |
| Activity : | sour |
|||
| Chemical mass | 576.5528 | Monoisotopic mass | 576.2382 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H. | |
| Title | |
| Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693, 1995 | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O InChI=1S/C22H36N6O12/c23-8-2-1-3-11(24)19(36)25-10-15(29)26-14(9-18(34)35)21(38)27-12(4-6-16(30)31)20(37)28-13(22(39)40)5-7-17(32)33/h11-14H,1-10,23-24H2,(H,25,36)(H,26,29)(H,27,38)(H,28,37)(H,30,31)(H,32,33)(H,34,35)(H,39,40)/t11-,12-,13-,14-/m0/s1 InChIKey: DCRFNMACZXSQPQ-XUXIUFHCSA-N Annotated as salty at pH 6 and sour/salty/sweet in acidic environment: Nakata T., Takahashi M., Nakatani M., Kuramitsu R., Tamura M., Okai H., 1995, Role of basic and acidic fragments in delicious peptides (Lys-Gly-Asp-Glu-Glu-Ser-Leu-Ala) and the taste behavior of sodium and potassium salts in acidic oligopeptides. Biosci. Biotech. Biochem., 59, 689-693; Salty taste: BIOPEP ID 302; Sweet taste: BIOPEP ID 303 |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 302; 303 |