BIOPEP-UWM: Report
| ID | 307 |
| Name | sweet amino acid |
| sequence |
| Function: | |||
| Number of residues | 1 |
Activity code | swe |
| Activity : | sweet |
|||
| Chemical mass | 89.0929 | Monoisotopic mass | 89.0475 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tamura M., Miyoshi T., Mori N., Kinomura K., Kawaguchi M., Ishibashi N., Okai H. | |
| Title | |
| Mechanizm of bitter casting potency of peptides using O-aminoacyl sugars as model compounds. Agric. Biol. Chem., 54, 1401-1409, 1990 | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: C[C@@H](C(=O)O)N InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 InChIKey: QNAYBMKLOCPYGJ-REOHCLBHSA-N Another reference concerning sweet taste: Tamura M., Miyoshi T., Mori N., Kinomura K., Kawaguchi M., Ishibashi N., Okai H., 1990, Mechanism of bitter casting potency of peptides using O-aminoacyl sugars as model compounds. Agric. Biol. Chem., 54, 1401-1409 |
| Database reference: |
| ACToR: ID 56-41-7 BRENDA: Ligand L-Ala; L-alanine ChEBI: ID 16977 ChEMBL: ID CHEMBL279597 ChemSpider: ID 5735 Human Metabolome Database (HMDB): ID HMDB00161 KEGG: compound C00041 PubChem: ID 5950 ZINC: ID ZINC04658553 |