BIOPEP-UWM: Report
| ID | 316 |
| Name | Sour peptide |
| sequence |
| Function: | |||
| sour | |||
| Number of residues | 3 |
Activity code | sou |
| Activity : | sour |
|||
| Chemical mass | 390.3450 | Monoisotopic mass | 390.1381 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maehashi K., Matsuzaki M., Yamamoto Y., Udaka S. | |
| Title | |
| Isolation of peptides from an enzymatic hydrolysate of food proteins and characterization of their taste properties. Biosci. Biotech. Biochem., 63, 555-559, 1999 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(=O)N)CCC(=O)O)CCC(=O)O InChI=1S/C14H22N4O9/c15-6(1-3-10(20)21)12(24)17-7(2-4-11(22)23)13(25)18-8(14(26)27)5-9(16)19/h6-8H,1-5,15H2,(H2,16,19)(H,17,24)(H,18,25)(H,20,21)(H,22,23)(H,26,27)/t6-,7-,8-/m0/s1 InChiKey: QQLBPVKLJBAXBS-FXQIFTODSA-N Peptide found in chicken meat protein hydrolysate: Maehashi K., Matsuzaki M., Yamamoto Y., Udaka, S. 1999, Isolation of peptides from an enzymatic hydrolysate of food proteins and characterization of their taste properties. Biosci. Biotech. Biochem., 63, 555-559; Reveals also bitter taste: BIOPEP ID 317 |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 317 |