BIOPEP-UWM: Report
| ID | 322 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami peptide | |||
| Number of residues | 3 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 389.3998 | Monoisotopic mass | 389.1791 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Monastyrskaia K., Lundstrom K., Plahl D., Acuna G., Schweitzer C., Malherbe P., Mutel V. | |
| Title | |
| Effect of the umami peptides on the ligand binding and function of rat mGlu4a receptor might implicate this receptor in the monosodium glutamate taste transduction. Brit. J. Pharmacol., 128, 1027-1034, 1999 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CCC(=O)O)CCC(=O)O InChI=1S/C16H27N3O8/c1-8(2)7-11(16(26)27)19-15(25)10(4-6-13(22)23)18-14(24)9(17)3-5-12(20)21/h8-11H,3-7,17H2,1-2H3,(H,18,24)(H,19,25)(H,20,21)(H,22,23)(H,26,27)/t9-,10-,11-/m0/s1 InChIKey: MUSGDMDGNGXULI-DCAQKATOSA-N |
| Database reference: |
| BRENDA: Ligand Glu-Glu-Leu ChemSpider: ID 414190 PubChem: ID 471576 |