BIOPEP-UWM: Report
| ID | 338 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 317.3819 | Monoisotopic mass | 317.1734 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W. | |
| Title | |
| Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)Cc1c[nH]c2c1cccc2 InChI=1S/C17H23N3O3/c1-10(2)7-15(17(22)23)20-16(21)13(18)8-11-9-19-14-6-4-3-5-12(11)14/h3-6,9-10,13,15,19H,7-8,18H2,1-2H3,(H,20,21)(H,22,23)/t13-,15-/m0/s1 InChIKey: LYMVXFSTACVOLP-ZFWWWQNUSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP database of bioactive peptides (ID 8677) Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database; BIOPEP database of bioactive peptides (ID 9107); BRENDA database; EROP-Moscow database Inhibitor of Peroxisome proliferator-activated receptor gamma according to BindingDB database; ChEMBL database |
| Database reference: |
| AHTPDB: ID 1463; 1900; 2968; 4724; 5181; 6216; 6220; 6862 BindingDB: ID 50266681 BIOPEP database of bioactive peptides: ID 8677; 9107 BitterDB: ID 830 BRENDA: Ligand Trp-Leu ChEBI: ID 74871 ChEMBL: ID CHEMBL477627 ChemSpider: ID 5365198 EROP-Moscow: ID E06385 J-GLOBAL: ID 200907089186452560 PubChem: ID 6997509 SATPdb: ID satpdb20928 Therapeutic Target Database (TTD): ID DNC009657 ZINC: ID ZINC01865984 |