BIOPEP-UWM: Report
| ID | 34 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.43 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 295.2905 | Monoisotopic mass | 295.1164 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: c1cc(ccc1C[C@@H](C(=O)NCC(=O)NCC(=O)O)N)O InChI=1S/C13H17N3O5/c14-10(5-8-1-3-9(17)4-2-8)13(21)16-6-11(18)15-7-12(19)20/h1-4,10,17H,5-7,14H2,(H,15,18)(H,16,21)(H,19,20)/t10-/m0/s1 InChIKey: HIINQLBHPIQYHN-JTQLQIEISA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database; BIOPEP database of bioactive peptides (ID 7647) Immunomodulating peptide according to BIOPEP database of bioactive peptides (ID 3741); EROP-Moscow database Inhibitor of citrulline uptake in yeasts according to ChEMBL database; PubChem database |
| Database reference: |
| ACToR: ID 21778-69-8 AHTPDB: ID 1592; 3315; 4560; 4845; 5474; 6634 BIOPEP database of bioactive peptides: ID 3741; 7647 BRENDA: Ligand Tyr-Gly-Gly ChEBI: ID 74991 ChEMBL: ID CHEMBL191422 ChemSpider: ID 110288 EROP-Moscow: ID E09286 PubChem: ID 123715 ZINC: ID ZINC02575477 |