BIOPEP-UWM: Report
| ID | 340 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 351.3982 | Monoisotopic mass | 351.1578 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W. | |
| Title | |
| Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C20H21N3O3/c21-16(11-14-12-22-17-9-5-4-8-15(14)17)19(24)23-18(20(25)26)10-13-6-2-1-3-7-13/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1 InChIKey=IMMPMHKLUUZKAZ-WMZOPIPTSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP-UWM database of bioactive peptides (ID 8692) |
| Database reference: |
| BIOPEP-UWM database of bioactive pdeptides: ID 8692 BIOPEP-UWM database of sensory peptides and amino acids: ID 340 BRENDA: Ligand Trp-Phe CAS: Registry No 6686-02-8 ChEBI: ID 74874 ChEMBL: ID CHEMBL288827 ChemSpider: ID 4932360 EPA DSSTox: ID DTXSID00985484 PepHammer: ID 22476 Peptipedia: ID 22476 PubChem: CID 6426942 SureChEMBL: ID 9308524 UniChem: ID 581388 Wikidata: ID Q27144985 ZINC: ID ZINC02033819 |