BIOPEP-UWM: Report
| ID | 341 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 301.3396 | Monoisotopic mass | 301.1422 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W. | |
| Title | |
| Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N1[C@H](C(=O)O)CCC1)Cc1c[nH]c2c1cccc2 InChI=1S/C16H19N3O3/c17-12(15(20)19-7-3-6-14(19)16(21)22)8-10-9-18-13-5-2-1-4-11(10)13/h1-2,4-5,9,12,14,18H,3,6-8,17H2,(H,21,22)/t12-,14-/m0/s1 InChIKey: DXYQIGZZWYBXSD-JSGCOSHPSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP database of bioactive peptides, BRENDA database, ChEMBL database, PubChem database Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database, EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 2795 BIOPEP database of bioactive peptides: ID 8504 BRENDA: Ligand Trp-Pro ChEMBL: ID CHEMBL417328 ChemSpider: ID 8015051 EROP-Moscow: ID E10414 PubChem: ID 9839333 ZINC: ID ZINC02572698 |