BIOPEP-UWM: Report
| ID | 342 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 390.4342 | Monoisotopic mass | 390.1687 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asao M., Iwamura H., Akamatsu M., Fujita T. | |
| Title | |
| Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](Cc1c2ccccc2[nH]c1)C(=O)N[C@@H](Cc1c2ccccc2[nH]c1)C(=O)O InChI=1S/C22H22N4O3/c23-17(9-13-11-24-18-7-3-1-5-15(13)18)21(27)26-20(22(28)29)10-14-12-25-19-8-4-2-6-16(14)19/h1-8,11-12,17,20,24-25H,9-10,23H2,(H,26,27)(H,28,29)/t17-,20-/m0/s1 InChIKey: NQIHMZLGCZNZBN-PXNSSMCTSA-N Another reference concerning bitterness: Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W., 2013, Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 Inhibitor of hemoglobin S gelation according to ChEMBL database, PubChem database Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP database of bioactive peptides; ChEMBL database; EROP-Moscow database, PubChem database |
| Database reference: |
BindingDB: ID 50188479 BIOPEP database of bioactive peptides: ID 8686 BitterDB: ID 832 BRENDA: Ligand Trp-Trp ChEBI: ID 74876 ChEMBL: ID CHEMBL286852 ChemIDplus: ID 020696600 ChemSpider: ID 79994 EROP-Moscow: ID E10612 PubChem: ID 88656 ZINC: ID ZINC01557161 |