BIOPEP-UWM: Report
| ID | 343 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 576.6437 | Monoisotopic mass | 576.2478 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W. | |
| Title | |
| Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](Cc1c2ccccc2[nH]c1)C(=O)N[C@@H](Cc1c2ccccc2[nH]c1)C(=O)N[C@@H](Cc1c2ccccc2[nH]c1)C(=O)O InChI=1S/C33H32N6O4/c34-25(13-19-16-35-26-10-4-1-7-22(19)26)31(40)38-29(14-20-17-36-27-11-5-2-8-23(20)27)32(41)39-30(33(42)43)15-21-18-37-28-12-6-3-9-24(21)28/h1-12,16-18,25,29-30,35-37H,13-15,34H2,(H,38,40)(H,39,41)(H,42,43)/t25-,29-,30-/m0/s1 InChIKey: KRCAKIVDAFTTGJ-ARVREXMNSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP database of bioactive peptides |
| Database reference: |
| BindingDB: ID 50169218 BIOPEP database of bioactive peptides: ID 8681 ChEMBL: ID CHEMBL434535 ChemSpider: ID 23257174 PubChem: ID 44398561 |