BIOPEP-UWM: Report
| ID | 348 |
| Name | Bitter amino acid |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 1 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 204.2247 | Monoisotopic mass | 204.0896 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Solms J., Vuataz L., Egli R. H. | |
| Title | |
| The taste of L- and D-amino acids. Experientia, XXI, 692-694 | |
| Year | Source |
| 1965 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)O)N InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 InChIKey: QIVBCDIJIAJPQS-VIFPVBQESA-N Another references concerning bitterness: Asao M., Iwamura H., Akamatsu M., Fujita T., 1987, Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879 Kohl S., Behrens M., Dunkel A., Hofmann T., Meyerhof W., 2013, Amino acids and peptides activate at least five members of the human bitter taste receptor family. J. Agric. Food Chem., 61, 53-60 |
| Database reference: |
| BindingDB: ID 21974 Biological Magnetic Resonance Data Bank: ID bmse000050 BitterDB: ID 827 BRENDA: Ligand Trp ChEBI: ID 16828 ChEMBL: ID CHEMBL54976 ChemIDplus: ID 000073223 ChemSpider: ID 6066 DrugBank: ID DB00150 FooDB: Compound L-Tryptophan (ID FDB002250) Golm Metabolome Database: 151A3008-4CFE-40C9-AC0B-467EF0CB50EA Human Metabolome Database (HMDB): ID HMDB00929 KEGG: Compound C00078 MetaCyc: Compound L-tryptophan MMDB: ID 19178; 19712; 16283; 16022; 17039; 18896; 18897; 10065; 11163; 2380 PubChem: ID 6305 ZINC: ID ZINC00083315 |