BIOPEP-UWM: Report
| ID | 351 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 2 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 190.1536 | Monoisotopic mass | 190.0587 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Noguchi M., Arai S., Yamashita M., Kato H., Fujimaki M. | |
| Title | |
| Isolation and identification of acidic oligopeptides occurring in a flavor potentiating fraction from a fish protein hydrolysate. J. Agric. Food Chem., 23, 49-53 | |
| Year | Source |
| 1975 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CC(=O)O)C(=O)NCC(=O)O InChI=1S/C6H10N2O5/c7-3(1-4(9)10)6(13)8-2-5(11)12/h3H,1-2,7H2,(H,8,13)(H,9,10)(H,11,12)/t3-/m0/s1 InChIKey: JHFNSBBHKSZXKB-VKHMYHEASA-N Bitter peptide according to the BIOPEP database of sensory peptides and amino acids (ID 352) Inhibitor of Angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP database of bioactive peptides; the BRENDA database; the ChEMBL database; the PubChem database; the SATPdb database |
| Database reference: |
| AHTPDB: ID 1042; 1265; 1404; 1492; 1694; 1830; 2911; 3161; 3189; 3263; 3317; 3471; 3826; 3896; 4396; 4532; 4666; 5141; 6224; 6667 BindingDB: ID 50188502 BIOPEP database of bioactive peptides: ID 7681 BIOPEP database of sensory peptides and amino acids: ID 352 BRENDA: Ligand Asp-Gly ChEBI: ID 73450 ChEMBL: ID CHEMBL421171 ChemIDplus: ID 003790510 ChemSpider: ID 133220 EROP-Moscow: ID E01843 PubChem: ID 151148 SATPdb: ID satpdb12356 ZINC: ID ZINC02384840 |