BIOPEP-UWM: Report
| ID | 354 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 232.2331 | Monoisotopic mass | 232.1055 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van den Oord A. H. A., van Wassenaar P. D. | |
| Title | |
| Umami peptides: assessment of their alleged taste properties. Z. Lebensm. Unters. Forsch., 205, 125-130, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@H](CC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C9H16N2O5/c1-4(2)7(9(15)16)11-8(14)5(10)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t5-,7-/m0/s1 InChIKey=CPMKYMGGYUFOHS-FSPLSTOPSA-N Sour peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 266) Peptide reported also as tasteless: Maehashi K., Matsuzaki M., Yamamoto Y., Udaka S., 1999, Isolation of peptides from an enzymatic hydrolysate of food proteins and characterization of their taste properties. Biosci., Biotech., Biochem., 63, 555-559 Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM Virtual database |
| Database reference: |
| AHTPDB: ID 5440 BindingDB: ID 50188511 BIOPEP-UWM database of sensory peptides and amino acids: ID 266 BRENDA: Ligand L-Asp-L-Val CAS: Registry No 13433-04-0 ChEBI: ID 73832 ChEMBL: ID CHEMBL441685 ChemSpider: ID 5373196 DFBP: ID DFBPACEI2422 EPA DSSTox: ID DTXSID001314995 J-GLOBAL: ID 200907089184433924 Metabolights: ID MTBLC73832 Metabolomics Workbench: ID 78735 Nikkaji: ID J81.615I PubChem: ID 7009616 SureChEMBL: ID 3785072 UniChem: ID 439450 Wikidata: ID Q27144150 ZINC: ID ZINC000002384839 |