BIOPEP-UWM: Report
| ID | 359 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 246.2596 | Monoisotopic mass | 246.1211 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Noguchi M., Arai S., Yamashita M., Kato H., Fujimaki M. | |
| Title | |
| Isolation and identification of acidic oligopeptides occurring in a flavor potentiating fraction from a fish protein hydrolysate. J. Agric. Food Chem., 23, 49-53, 1975 | |
| Year | Source |
| 1975 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)CC(=O)O)[C@H](CC)C InChI=1S/C10H18N2O5/c1-3-5(2)8(11)9(15)12-6(10(16)17)4-7(13)14/h5-6,8H,3-4,11H2,1-2H3,(H,12,15)(H,13,14)(H,16,17)/t5-,6-,8-/m0/s1 InChIKey: WKXVAXOSIPTXEC-HAFWLYHUSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1; MEROPS ID: XM02-001) according to the AHTPDB database |
| Database reference: |
| AHTPDB: ID 3865 ChEMBL: ID CHEMBL301604 ChemSpider: ID 23148794 EROP-Moscow: ID E01849 SATPdb: ID satpdb10253 |