BIOPEP-UWM: Report
| ID | 362 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 2 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 218.2066 | Monoisotopic mass | 218.0899 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Arai S., Yamashita M., Noguchi M., Fujimaki M. | |
| Title | |
| Tastes of L-glutamyl oligopeptides in relation to their chromatographic properties. Agric. Biol. Chem., 37, 151-156 | |
| Year | Source |
| 1973 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)O)C)CCC(=O)O InChI=1S/C8H14N2O5/c1-4(8(14)15)10-7(13)5(9)2-3-6(11)12/h4-5H,2-3,9H2,1H3,(H,10,13)(H,11,12)(H,14,15)/t4-,5-/m0/s1 InChIKey: JZDHUJAFXGNDSB-WHFBIAKZSA-N Angiotensin-converting enzyme (ACE) (EC 3.4.15.1; MEROPS ID: XM02-001) inhibitor according to the AHTPDB database; BIOPEP database of bioactive peptides; the ChEMBL database; the PubChem database Bitter peptide according to the BIOPEP database of sensory peptides and amino acids (ID 363) |
| Database reference: |
| AHTPDB: ID 2997; 3032; 3046; 3071; 3255; 3359; 3427; 3472; 3555; 3836; 3897; 4397; 4542; 4696; 6610 BindingDB: ID 50169155 BIOPEP database of bioactive peptides: ID 7623 BIOPEP database of sensory peptides and amino acids: ID 363 BRENDA: Ligand Glu-Ala ChEBI: ID 73849 ChEMBL: ID CHEMBL90074 ChemSpider: ID 5360636 PubChem: ID 6992506 SATPdb: ID satpdb18482 ZINC: ID ZINC01576200 |