BIOPEP-UWM: Report
| ID | 369 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 6 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 652.7848 | Monoisotopic mass | 652.2663 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dang Y., Gao X., Ma F., Wu X. | |
| Title | |
| Comparison of umami taste peptides in water-soluble extractions of Jinhua and Parma hams. LWT - Food Sci. Technol., 60, 1179-1186, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C24H44N8O9S2/c1-11(2)18(24(40)41)32-22(38)15(8-33)30-20(36)13(5-3-4-6-25)28-21(37)14(7-17(27)34)29-23(39)16(10-43)31-19(35)12(26)9-42/h11-16,18,33,42-43H,3-10,25-26H2,1-2H3,(H2,27,34)(H,28,37)(H,29,39)(H,30,36)(H,31,35)(H,32,38)(H,40,41)/t12-,13-,14-,15-,16-,18-/m0/s1 InChIKey: KJBIODKQSZOPGP-WELJMZOKSA-N |
| Database reference: |