BIOPEP-UWM: Report
| ID | 371 |
| Name | Bitterness suppressing amino acid |
| sequence |
| Function: | |||
| Bitterness suppressing | |||
| Number of residues | 1 |
Activity code | bis |
| Activity : | bitterness suppressing |
|||
| Chemical mass | 174.2004 | Monoisotopic mass | 174.1114 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Leksrisompong P., Gerard P., Lopetcharat K., Drake M. A. | |
| Title | |
| Bitter taste inhibiting agents for whey protein hydrolysate and whey protein hydrolysate beverages. J. Food Sci., 77, S282-S287, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids; SMILES: C(=O)([C@H](CCCNC(=N)N)N)O InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 InChiKey: ODKSFYDXXFIFQN-BYPYZUCNSA-N First reference concerning bitterness suppression Ogawa T., Hoshina K., Haginaka J., Honda C., Tanimoto T., Uchida T., 2005, Screening of bitterness-suppressing agents for quinine: the use of molecularly imprinted polymers. J. Pharm. Sci., 94, 353-362 Bitter amino acid according to the BIOPEP database of sensory peptides and amino acids (ID 1) |
| Database reference: |
| ACToR: ID 25212-18-4; BIOPEP database of sensory peptides and amino acids: ID 1; BRENDA: Ligand L-arginine; CHEBI: ID 16467; ChEMBL: ID CHEMBL1485; ChemSpider: ID 6082; FooDB: ID FDB002257; Human Metabolome Database: ID HMDB00517; KEGG Ligand: ID C0006; MetaCyc: Compound: L-arginine; PubChem: ID 6322 ZINC: ID ZINC01532525 |