BIOPEP-UWM: Report
| ID | 373 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste, detection threshold 0.43 mMol | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 585.6454 | Monoisotopic mass | 585.2999 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhuang M., Lin L., Zhao M., Dong Y., Sun-Waterhouse D., Chen H., Qiu C., Su G. | |
| Title | |
| Sequence, taste and umami-enhancing effect of the peptides separated from soy sauce. Food Chem., 206, 174-181, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)CCC(=O)O)CCC(=O)O)CCC1)CC(C)C InChI=1S/C26H43N5O10/c1-13(2)12-15(27)25(39)31-11-5-6-18(31)24(38)29-16(7-9-19(32)33)22(36)28-17(8-10-20(34)35)23(37)30-21(14(3)4)26(40)41/h13-18,21H,5-12,27H2,1-4H3,(H,28,36)(H,29,38)(H,30,37)(H,32,33)(H,34,35)(H,40,41)/t15-,16-,17-,18-,21-/m0/s1 InChIKey: VXLXGVJRWZYYSR-SOADLSRISA-N Umami enhancing peptide according to the BIOPEP database of sensory peptides and amino acids (ID 374) |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 374 |