BIOPEP-UWM: Report
| ID | 375 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste, detection threshold 1.25 mMol | |||
| Number of residues | 8 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 799.8699 | Monoisotopic mass | 799.4175 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhuang M., Lin L., Zhao M., Dong Y., Sun-Waterhouse D., Chen H., Qiu C., Su G. | |
| Title | |
| Sequence, taste and umami-enhancing effect of the peptides separated from soy sauce. Food Chem., 206, 174-181, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C)CCC(=O)N)C)CCC(=O)N)CC(C)C)C)CCC(=O)N)C InChI=1S/C33H57N11O12/c1-14(2)13-22(44-28(50)17(5)39-29(51)19(7-10-23(35)45)41-26(48)15(3)34)32(54)43-21(9-12-25(37)47)30(52)38-16(4)27(49)42-20(8-11-24(36)46)31(53)40-18(6)33(55)56/h14-22H,7-13,34H2,1-6H3,(H2,35,45)(H2,36,46)(H2,37,47)(H,38,52)(H,39,51)(H,40,53)(H,41,48)(H,42,49)(H,43,54)(H,44,50)(H,55,56)/t15-,16-,17-,18-,19-,20-,21-,22-/m0/s1 InChIKey: SRHYVUHJHQXBDA-JOFXYRRGSA-N |
| Database reference: |