BIOPEP-UWM: Report
| ID | 379 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic hydrolysate of casein. Showed the bitterness in 0.1% water solution. The bitterness of GPFPVI was identical as in 0.1% phenylalanine water solution. | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 628.7576 | Monoisotopic mass | 628.3573 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matoba T., Hata T. | |
| Title | |
| Relationship between bitterness of peptides and their chemical structures. Agric Biol. Chem. 36, 1423 – 1431, 1972. | |
| Year | Source |
| 1972 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)[C@H](CC)C)C(C)C)CCC2)Cc2ccccc2)CCC1 InChI=1S/C32H48N6O7/c1-5-20(4)27(32(44)45)36-30(42)26(19(2)3)35-29(41)24-14-10-16-38(24)31(43)22(17-21-11-7-6-8-12-21)34-28(40)23-13-9-15-37(23)25(39)18-33/h6-8,11-12,19-20,22-24,26-27H,5,9-10,13-18,33H2,1-4H3,(H,34,40)(H,35,41)(H,36,42)(H,44,45)/t20-,22-,23-,24-,26-,27-/m0/s1 InChIKey: PCGNLGAMFFODMW-PQJTZWKESA-N First reference concerning bitterness: Matoba T., Nagayashi C., Hayashi R., Hata T., 1969, Bitter peptides in tryptic hydrolysate of casein. Agric. Biol. Chem., 33, 1662-1663 |
| Database reference: |
| EROP-Moscow: ID E01835 |