BIOPEP-UWM: Report
| ID | 381 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic 11 S soy glycinin hydrolysate. | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 888.8737 | Monoisotopic mass | 888.3811 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kim M.-R., Kawamura Y., Lee C.-H. | |
| Title | |
| Isolation and Identification of Bitter Peptides of Tryptic Hydrolysate of Soybean 11S Glycinin by Reverse-phase High Performance Liquid Chromatography. J. Food Sci., 68, 8, 2416-2422, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)CCC(=O)O)CCC(=O)O)CCC(=O)N)CC(=O)N)C)CC(C)C InChI=1S/C35H56N10O17/c1-15(2)12-17(36)30(56)40-16(3)29(55)39-14-25(48)41-22(13-24(38)47)34(60)44-18(4-8-23(37)46)31(57)42-19(5-9-26(49)50)32(58)43-20(6-10-27(51)52)33(59)45-21(35(61)62)7-11-28(53)54/h15-22H,4-14,36H2,1-3H3,(H2,37,46)(H2,38,47)(H,39,55)(H,40,56)(H,41,48)(H,42,57)(H,43,58)(H,44,60)(H,45,59)(H,49,50)(H,51,52)(H,53,54)(H,61,62)/t16-,17-,18-,19-,20-,21-,22-/m0/s1 InChIKey: DLIRUNUJZJIMMQ-CPDXTSBQSA-N |
| Database reference: |