BIOPEP-UWM: Report
| ID | 388 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic 11 S soy glycinin hydrolysate. | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 430.4549 | Monoisotopic mass | 430.2169 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kim M.-R., Kawamura Y., Lee C.-H. | |
| Title | |
| Isolation and Identification of Bitter Peptides of Tryptic Hydrolysate of Soybean 11S Glycinin by Reverse-phase High Performance Liquid Chromatography. J. Food Sci., 68, 8, 2416-2422, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)O)CCC(=O)N)CC(C)C)CC(=O)N InChI=1S/C17H30N6O7/c1-8(2)5-11(23-15(28)9(18)6-13(20)25)17(30)22-10(3-4-12(19)24)16(29)21-7-14(26)27/h8-11H,3-7,18H2,1-2H3,(H2,19,24)(H2,20,25)(H,21,29)(H,22,30)(H,23,28)(H,26,27)/t9-,10-,11-/m0/s1 InChIKey: RMQLSNUFJGAPQK-DCAQKATOSA-N |
| Database reference: |