BIOPEP-UWM: Report
| ID | 390 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic 11 S soy glycinin hydrolysate. | |||
| Number of residues | 10 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1078.0871 | Monoisotopic mass | 1077.4711 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kim M.-R., Kawamura Y., Lee C.-H. | |
| Title | |
| Isolation and Identification of Bitter Peptides of Tryptic Hydrolysate of Soybean 11S Glycinin by Reverse-phase High Performance Liquid Chromatography. J. Food Sci., 68, 8, 2416-2422, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(=O)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)O InChI=1S/C45H67N13O18/c1-4-21(2)36(56-39(69)26(17-35(65)66)54-41(71)30-8-6-14-58(30)44(74)28(16-31(47)59)51-32(60)19-49-37(67)22(3)46)42(72)52-24(9-11-33(61)62)38(68)55-27(15-23-18-48-20-50-23)43(73)57-13-5-7-29(57)40(70)53-25(45(75)76)10-12-34(63)64/h18,20-22,24-30,36H,4-17,19,46H2,1-3H3,(H2,47,59)(H,48,50)(H,49,67)(H,51,60)(H,52,72)(H,53,70)(H,54,71)(H,55,68)(H,56,69)(H,61,62)(H,63,64)(H,65,66)(H,75,76)/t21-,22-,24-,25-,26-,27-,28-,29+,30+,36-/m0/s1 InChIKey: XSWHSZAQAYXWFI-DSOKEVKESA-N |
| Database reference: |