BIOPEP-UWM: Report
| ID | 391 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter peptide identified in tryptic 11 S soy glycinin hydrolysate. | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 877.8957 | Monoisotopic mass | 877.3917 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kim M.-R., Kawamura Y., Lee C.-H. | |
| Title | |
| Isolation and Identification of Bitter Peptides of Tryptic Hydrolysate of Soybean 11S Glycinin by Reverse-phase High Performance Liquid Chromatography. J. Food Sci., 68, 8, 2416-2422, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)O)CCC2)Cc2[nH]cnc2)CCC(=O)O)[C@H](CC)C)CC(=O)O)CCC1)CC(=O)N InChI=1S/C37H55N11O14/c1-3-18(2)30(46-32(56)21(14-29(53)54)44-33(57)24-6-4-10-47(24)36(60)23(13-26(39)49)42-27(50)15-38)34(58)43-20(8-9-28(51)52)31(55)45-22(12-19-16-40-17-41-19)35(59)48-11-5-7-25(48)37(61)62/h16-18,20-25,30H,3-15,38H2,1-2H3,(H2,39,49)(H,40,41)(H,42,50)(H,43,58)(H,44,57)(H,45,55)(H,46,56)(H,51,52)(H,53,54)(H,61,62)/t18-,20-,21-,22-,23-,24-,25-,30-/m0/s1 InChIKey: ZEFIZDMDNNVNEJ-PYOUFKTKSA-N |
| Database reference: |